CAS 105107-84-4
:cis-4-Phenylthio-L-proline hydrochloride
Description:
Cis-4-Phenylthio-L-proline hydrochloride is a chemical compound characterized by its unique structural features and properties. It is a derivative of proline, an amino acid, with a phenylthio group attached at the 4-position, which influences its biological activity and solubility. The "cis" configuration indicates that the substituents around the proline ring are oriented on the same side, which can affect its conformation and interactions with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical research. This compound is of interest in the study of peptide synthesis and may exhibit specific pharmacological properties due to its structural characteristics. Its CAS number, 105107-84-4, allows for precise identification in chemical databases and literature. Overall, cis-4-Phenylthio-L-proline hydrochloride serves as a valuable compound in both synthetic chemistry and medicinal chemistry research.
Formula:C11H14ClNO2S
InChI:InChI=1/C11H13NO2S.ClH/c13-11(14)10-6-9(7-12-10)15-8-4-2-1-3-5-8;/h1-5,9-10,12H,6-7H2,(H,13,14);1H/t9-,10-;/m0./s1
SMILES:c1ccc(cc1)S[C@H]1C[C@@H](C(=O)O)NC1.Cl
Synonyms:- (4S)-4-(Phenylthio)-L-proline hydrochloride
- (4S)-4-(phenylsulfanyl)-L-proline hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
cis-4-Phenylthio-L-proline hydrochloride
CAS:Formula:C11H14ClNO2SPurity:97%Color and Shape:SolidMolecular weight:259.7524Cis-4-Phenylthio-L-Proline Hydrochloride
CAS:Cis-4-Phenylthio-L-Proline HydrochloridePurity:98%Molecular weight:259.75g/mol(4S)-4-(Phenylthio)-L-proline Hydrochloride
CAS:Applications (4S)-4-(Phenylthio)-L-proline is an impurity of Zofenopril (Z587000).
References Krapcho, J., et al.: J. Med. Chem., 31, 1148 (1988),Formula:C11H14ClNO2SColor and Shape:NeatMolecular weight:259.75cis-4-Phenylthio-L-prolineHydrochloride
CAS:Zofenopril calcium is a potassium-containing salt of zofenopril, a prodrug that is hydrolyzed in vivo to the active form, 4-phenylthio-L-proline. Zofenopril calcium is used as an antihypertensive agent and has a low incidence of adverse effects. It inhibits the enzyme angiotensin converting enzyme (ACE) in the renin-angiotensin system, which results in decreased levels of angiotensin II and subsequent vasodilation.
Formula:C11H14ClNO2SPurity:Min. 95%Molecular weight:259.75 g/mol






