CAS 105118-14-7
:Datelliptium chloride
Description:
Datelliptium chloride, identified by its CAS number 105118-14-7, is a chemical compound that belongs to a class of substances known for their unique properties. While specific details about Datelliptium chloride may not be widely documented, compounds with similar structures often exhibit characteristics such as high reactivity and potential applications in various fields, including materials science and catalysis. Typically, metal chlorides can display ionic bonding, leading to high melting and boiling points, as well as solubility in polar solvents. Additionally, they may participate in coordination chemistry, forming complexes with ligands. The presence of the metal in Datelliptium chloride suggests it may have interesting electronic properties, possibly making it useful in electronic or photonic applications. However, due to the limited availability of specific data, further research would be necessary to fully understand its behavior, safety profile, and potential applications in industrial or laboratory settings. Always consult safety data sheets and relevant literature when handling or studying chemical substances.
Formula:C23H28ClN3O
InChI:InChI=1/C23H27N3O.ClH/c1-5-25(6-2)11-12-26-10-9-18-16(4)23-22(15(3)20(18)14-26)19-13-17(27)7-8-21(19)24-23;/h7-10,13-14,27H,5-6,11-12H2,1-4H3;1H
SMILES:CCN(CC)CCn1ccc2c(C)c3c(c(C)c2c1)c1cc(ccc1n3)O.Cl
Synonyms:- Datelliptium chloride [INN]
- 2-(2-(Diethylamino)ethyl)-9-hydroxy-5,11-dimethyl-6H-pyrido(4,3-b)carbazolium chloride
- Chlorure de datelliptium
- Chlorure de datelliptium [French]
- Cloruro de dateliptio
- Cloruro de dateliptio [Spanish]
- Datelliptii chloridum
- Datelliptii chloridum [Latin]
- N-2-(Diethylaminoethyl)-9-hydroxyellipticinum chloride
- Unii-L374Y6We0D
- Unii-V5Qkf7Q20O
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Datelliptium chloride
CAS:Datelliptium chloride is a DNA-intercalating agent derived from ellipticine. Datelliptium chloride shows anti-tumor activities.Formula:C23H28ClN3OPurity:98%Color and Shape:SolidMolecular weight:397.94
