CAS 10512-89-7: (2S,3S)-3-METHYLPYRROLIDINE-2-CARBOXYLIC ACID

Description:(2S,3S)-3-Methylpyrrolidine-2-carboxylic acid, also known as L-proline, is an amino acid characterized by its five-membered pyrrolidine ring structure, which includes a carboxylic acid functional group. This compound is a chiral molecule, existing in two enantiomeric forms, with the (2S,3S) configuration being the naturally occurring form. It is a colorless to pale yellow solid that is soluble in water and polar organic solvents. The presence of the carboxylic acid group contributes to its acidic properties, while the methyl group at the third position influences its steric and electronic characteristics. This amino acid plays a crucial role in protein synthesis and is involved in various metabolic pathways. Additionally, it is known for its role in collagen synthesis and is often studied for its potential therapeutic applications in wound healing and tissue repair. Its unique structure and properties make it a valuable compound in both biochemical research and pharmaceutical development.

Formula:C₆H₁₁NO₂

InChI:InChI=1/C6H11NO2/c1-4-2-3-7-5(4)6(8)9/h4-5,7H,2-3H2,1H3,(H,8,9)/t4-,5-/m0/s1

Synonyms:
D-3-Methylproline
3-Methyl-L-Proline
Trans-3-Methyl-L-Proline
(3S)-3-methyl-L-proline

Found 4 products.

Product data	Purity	Price range	Estimated delivery
(2S,3S)-3-Methylpyrrolidine-2-carboxylic acid REF: IN-DA0085CXCAS: 10512-89-7	97%	To inquire	Wed 16 Apr 25
(2S,3S)-3-Methylpyrrolidine-2-carboxylic acid, 97% REF: AC-29009CAS: 10512-89-7	97%	214.00 €~735.00 €	Mon 21 Apr 25
(2S,3S)-3-Methylpyrrolidine-2-carboxylic acid REF: 10-F432392CAS: 10512-89-7	95.0%	To inquire	Mon 28 Apr 25
(2S,3S)-3-Methylpyrrolidine-2-carboxylicacid REF: 3D-FM148365CAS: 10512-89-7	Min. 95%	- - -	Discontinued product