
CAS 10512-94-4
:N-[(Phenylmethoxy)carbonyl]-D-valine 4-nitrophenyl ester
Description:
N-[(Phenylmethoxy)carbonyl]-D-valine 4-nitrophenyl ester, with the CAS number 10512-94-4, is a chemical compound that belongs to the class of amino acid derivatives. It features a D-valine backbone, which is an essential amino acid, modified by the addition of a phenylmethoxycarbonyl (Pmc) group and a 4-nitrophenyl ester moiety. This structure imparts specific characteristics, such as increased lipophilicity and potential for bioactivity, making it of interest in pharmaceutical applications. The presence of the nitrophenyl group can enhance the compound's reactivity, particularly in esterification and hydrolysis reactions. Additionally, the Pmc group serves as a protective group in peptide synthesis, allowing for selective reactions. The compound is typically used in research settings, particularly in the development of peptide-based drugs or as a building block in organic synthesis. Its stability, solubility, and reactivity are influenced by the functional groups present, making it a versatile intermediate in chemical synthesis.
Formula:C19H20N2O6
InChI:InChI=1S/C19H20N2O6/c1-13(2)17(20-19(23)26-12-14-6-4-3-5-7-14)18(22)27-16-10-8-15(9-11-16)21(24)25/h3-11,13,17H,12H2,1-2H3,(H,20,23)/t17-/m1/s1
InChI key:InChIKey=GLFONBITBIYJPS-QGZVFWFLSA-N
SMILES:O(C([C@H](NC(OCC1=CC=CC=C1)=O)C(C)C)=O)C2=CC=C(N(=O)=O)C=C2
Synonyms:- N-[(Phenylmethoxy)carbonyl]-D-valine 4-nitrophenyl ester
- N-(Benzyloxycarbonyl)-D-valine p-nitrophenyl ester
- Valine, N-carboxy-, N-benzyl p-nitrophenyl ester, D-
- D-Valine, N-[(phenylmethoxy)carbonyl]-, 4-nitrophenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.