CAS 105126-91-8

2-[(3-Methoxyphenyl)thio]acetaldehyde

Description:

2-[(3-Methoxyphenyl)thio]acetaldehyde, with the CAS number 105126-91-8, is an organic compound characterized by the presence of a thioether functional group and an aldehyde group. It features a methoxy-substituted phenyl ring attached to a thioether linkage, which contributes to its unique chemical properties. The compound is typically a colorless to pale yellow liquid with a distinct odor, indicative of its aldehyde functionality. It is soluble in organic solvents, such as ethanol and ether, but may have limited solubility in water due to its hydrophobic aromatic structure. The presence of the thioether group can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and synthetic organic chemistry. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.

Formula: C₉H₁₀O₂S

InChI: InChI=1S/C9H10O2S/c1-11-8-3-2-4-9(7-8)12-6-5-10/h2-5,7H,6H2,1H3

InChI key: InChIKey=LIQQUIOSCAHCIZ-UHFFFAOYSA-N

SMILES: S(CC=O)C1=CC(OC)=CC=C1

Synonyms:

• (3-Methoxyphenylsulphanyl)acetaldehyde
• 2-[(3-Methoxyphenyl)sulfanyl]acetaldehyde
• 2-[(3-Methoxyphenyl)thio]acetaldehyde
• Acetaldehyde, 2-[(3-methoxyphenyl)thio]-
• Acetaldehyde, [(3-methoxyphenyl)thio]-