CAS 10513-96-9

2,2'-propane-1,3-diylbis(1H-isoindole-1,3(2H)-dione)

Description:

2,2'-Propane-1,3-diylbis(1H-isoindole-1,3(2H)-dione), also known by its CAS number 10513-96-9, is a synthetic organic compound characterized by its unique structure, which features two isoindole-1,3-dione moieties linked by a propane-1,3-diyl group. This compound typically exhibits properties associated with diketones, including potential reactivity due to the presence of carbonyl groups. It may display moderate solubility in organic solvents, while its solubility in water is likely limited due to its hydrophobic isoindole components. The compound may also exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with anti-cancer or anti-inflammatory properties. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through empirical studies. Overall, 2,2'-propane-1,3-diylbis(1H-isoindole-1,3(2H)-dione) represents a complex organic molecule with potential utility in various chemical and biological applications.

Formula: C₁₉H₁₄N₂O₄

InChI: InChI=1/C19H14N2O4/c22-16-12-6-1-2-7-13(12)17(23)20(16)10-5-11-21-18(24)14-8-3-4-9-15(14)19(21)25/h1-4,6-9H,5,10-11H2

SMILES: c1ccc2c(c1)C(=O)N(CCCN1C(=O)c3ccccc3C1=O)C2=O

Synonyms:

• 1,3-Diphthalimido-propane

N,N'-Trimethylenediphthalimide-d6

Controlled Product

CAS: 10513-96-9

Formula: C₁₉H₈D₆N₂O₄

Color and Shape: Neat

Molecular weight: 340.36

Ref: TR-T796377