CymitQuimica logo

CAS 1051316-28-9

:

3-Methoxy-6-quinolinemethanol

Description:
3-Methoxy-6-quinolinemethanol, identified by its CAS number 1051316-28-9, is a chemical compound that features a quinoline structure, which is a bicyclic aromatic compound known for its diverse biological activities. This substance contains a methoxy group (-OCH3) and a hydroxymethyl group (-CH2OH) attached to the quinoline ring, contributing to its potential reactivity and solubility properties. The presence of the methoxy group can enhance lipophilicity, while the hydroxymethyl group may facilitate hydrogen bonding interactions. Compounds of this nature are often investigated for their pharmacological properties, including antimicrobial and anticancer activities. Additionally, the structural characteristics of 3-Methoxy-6-quinolinemethanol may allow for various synthetic modifications, making it a candidate for further research in medicinal chemistry. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods and may vary based on the conditions under which they are measured.
Formula:C11H11NO2
InChI:InChI=1S/C11H11NO2/c1-14-10-5-9-4-8(7-13)2-3-11(9)12-6-10/h2-6,13H,7H2,1H3
InChI key:InChIKey=ZSMXYCFMTWEFMG-UHFFFAOYSA-N
SMILES:O(C)C1=CC2=C(C=CC(CO)=C2)N=C1
Synonyms:
  • 6-Quinolinemethanol, 3-methoxy-
  • (3-Methoxyquinolin-6-yl)methanol
  • 3-Methoxy-6-quinolinemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.