
CAS 105132-92-1
:Gnetin H
Description:
Gnetin H is a naturally occurring chemical compound classified as a flavonoid, specifically a type of stilbene. It is primarily found in certain species of the Gnetum plant, which is part of the Gnetaceae family. This compound is characterized by its unique chemical structure, which includes multiple hydroxyl groups that contribute to its antioxidant properties. Gnetin H has garnered interest in the field of pharmacology due to its potential health benefits, including anti-inflammatory and anticancer activities. Its bioactivity is attributed to its ability to modulate various biochemical pathways, making it a subject of research in natural product chemistry and medicinal applications. Additionally, Gnetin H may exhibit synergistic effects when combined with other phytochemicals, enhancing its therapeutic potential. As with many flavonoids, its solubility and stability can be influenced by environmental factors, which is important for its application in dietary supplements and functional foods. Further studies are ongoing to fully elucidate its mechanisms of action and potential uses in health and disease management.
Formula:C42H32O9
InChI:InChI=1S/C42H32O9/c43-27-8-1-22(2-9-27)3-14-34-39-35(50-41(23-4-10-28(44)11-5-23)37(39)25-15-30(46)19-31(47)16-25)21-36-40(34)38(26-17-32(48)20-33(49)18-26)42(51-36)24-6-12-29(45)13-7-24/h1-21,37-38,41-49H/b14-3+/t37-,38-,41+,42+/m0/s1
InChI key:InChIKey=PHIHHTIYURVLDB-JPZOQBBBSA-N
SMILES:C(=C/C1=CC=C(O)C=C1)\C2=C3[C@@H]([C@H](OC3=CC4=C2[C@@H]([C@H](O4)C5=CC=C(O)C=C5)C6=CC(O)=CC(O)=C6)C7=CC=C(O)C=C7)C8=CC(O)=CC(O)=C8
Synonyms:- Benzo[1,2-b:5,4-b′]difuran, 1,3-benzenediol deriv.
- 1,3-Benzenediol, 5,5′-[2,3,5,6-tetrahydro-2,6-bis(4-hydroxyphenyl)-4-[2-(4-hydroxyphenyl)ethenyl]benzo[1,2-b:5,4-b′]difuran-3,5-diyl]bis-, [2S-[2α,3β,4(E),5α,6β]]-
- 5,5′-[(2S,3S,5S,6S)-2,3,5,6-Tetrahydro-2,6-bis(4-hydroxyphenyl)-4-[(1E)-2-(4-hydroxyphenyl)ethenyl]benzo[1,2-b:5,4-b′]difuran-3,5-diyl]bis[1,3-benzenediol]
- Gnetin H
- 1,3-Benzenediol, 5,5′-[(2S,3S,5S,6S)-2,3,5,6-tetrahydro-2,6-bis(4-hydroxyphenyl)-4-[(1E)-2-(4-hydroxyphenyl)ethenyl]benzo[1,2-b:5,4-b′]difuran-3,5-diyl]bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Gnetin H
CAS:<p>Gnetin H is a useful organic compound for research related to life sciences. The catalog number is T126475 and the CAS number is 105132-92-1.</p>Formula:C42H32O9Color and Shape:SolidMolecular weight:680.709
