CAS 1051363-50-8

2-Butanamine, N-(3-phenyl-2-propyn-1-yl)-, hydrochloride (1:1)

Description:

2-Butanamine, N-(3-phenyl-2-propyn-1-yl)-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group and a substituted alkyne moiety. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in aqueous solutions. The presence of the butanamine structure suggests that it may exhibit basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. The phenyl and propynyl substituents contribute to its potential for aromatic interactions and may influence its biological activity. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for drug design or synthesis. Additionally, its hydrochloride form indicates that it can be used in various applications, including research and development in pharmaceuticals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₁₃H₁₇N·ClH

InChI: InChI=1S/C13H17N.ClH/c1-3-12(2)14-11-7-10-13-8-5-4-6-9-13;/h4-6,8-9,12,14H,3,11H2,1-2H3;1H

InChI key: InChIKey=HPSARMAPBOZOQK-UHFFFAOYSA-N

SMILES: C(#CCNC(CC)C)C1=CC=CC=C1.Cl

Synonyms:

• 2-Butanamine, N-(3-phenyl-2-propyn-1-yl)-, hydrochloride (1:1)