
CAS 1051368-95-6
:Quinoline, 1,2,3,4-tetrahydro-2,2,4,6-tetramethyl-, hydrobromide (1:1)
Description:
Quinoline, 1,2,3,4-tetrahydro-2,2,4,6-tetramethyl-, hydrobromide (1:1) is a chemical compound characterized by its complex structure, which includes a quinoline backbone modified by tetrahydrogenation and multiple methyl groups. This compound is typically a white to off-white solid and is soluble in polar solvents. The presence of the hydrobromide indicates that it forms a salt with hydrobromic acid, which can influence its solubility and reactivity. Quinoline derivatives are known for their biological activity, often exhibiting properties such as antimicrobial, antimalarial, and antitumor effects. The specific arrangement of the methyl groups and the tetrahydro configuration can affect the compound's pharmacological properties and interactions with biological systems. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact. Proper safety protocols should be followed when working with this substance in laboratory settings.
Formula:C13H19N·BrH
InChI:InChI=1S/C13H19N.BrH/c1-9-5-6-12-11(7-9)10(2)8-13(3,4)14-12;/h5-7,10,14H,8H2,1-4H3;1H
InChI key:InChIKey=MYXVDUJWUYVCIM-UHFFFAOYSA-N
SMILES:CC1C=2C(NC(C)(C)C1)=CC=C(C)C2.Br
Synonyms:- Quinoline, 1,2,3,4-tetrahydro-2,2,4,6-tetramethyl-, hydrobromide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.