CAS 1051375-19-9: Dolutegravir sodium salt
Description:Dolutegravir sodium salt is an antiretroviral medication primarily used in the treatment of HIV infection. It belongs to the class of integrase strand transfer inhibitors (INSTIs), which work by blocking the integrase enzyme, thereby preventing the integration of viral DNA into the host genome. This compound is characterized by its high potency and favorable pharmacokinetic profile, allowing for once-daily dosing. Dolutegravir is known for its low potential for drug-drug interactions and is often used in combination with other antiretroviral agents to enhance efficacy and reduce the risk of resistance. The sodium salt form enhances its solubility and stability, making it suitable for oral administration. In clinical settings, it has demonstrated a strong ability to suppress viral load and improve immune function in patients. Additionally, Dolutegravir has a favorable safety profile, with a low incidence of adverse effects, although monitoring for potential side effects, such as hypersensitivity reactions and weight gain, is recommended. Overall, Dolutegravir sodium salt represents a significant advancement in HIV treatment regimens.
Formula:C20H19F2N3NaO5
InChI:InChI=1S/C20H19F2N3O5.Na/c1-10-4-5-30-15-9-24-8-13(17(26)18(27)16(24)20(29)25(10)15)19(28)23-7-11-2-3-12(21)6-14(11)22;/h2-3,6,8,10,15,27H,4-5,7,9H2,1H3,(H,23,28);/t10-,15+;/m1./s1
InChI key:InChIKey=FOZLBAIXQATFFW-VSLILLSYSA-N
SMILES:[Na].O=C(NCC1=CC=C(F)C=C1F)C2=CN3C(C(=O)N4C(OCCC4C)C3)=C(O)C2=O
- Synonyms:
- 2H-Pyrido[1',2':4,5]pyrazino[2,1-b][1,3]oxazine-9-carboxamide, N-[(2,4-difluorophenyl)methyl]-3,4,6,8,12,12a-hexahydro-7-hydroxy-4-methyl-6,8-dioxo-, sodium salt
- 2H-Pyrido[1′,2′:4,5]pyrazino[2,1-b][1,3]oxazine-9-carboxamide, N-[(2,4-difluorophenyl)methyl]-3,4,6,8,12,12a-hexahydro-7-hydroxy-4-methyl-6,8-dioxo-, sodium salt (1:1), (4R,12aS)-
- Dolutegravir sodium
- Gsk 1349572A