CAS 10514-60-0
:diethyl 1-methyl-1H-pyrazole-3,4-dicarboxylate
Description:
Diethyl 1-methyl-1H-pyrazole-3,4-dicarboxylate is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features two ester functional groups due to the presence of diethyl ester moieties attached to the dicarboxylic acid framework. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it useful in various chemical reactions and applications, particularly in organic synthesis and medicinal chemistry. The presence of the methyl group on the pyrazole ring can influence its reactivity and biological activity. Additionally, the compound may exhibit interesting properties such as potential anti-inflammatory or anti-cancer activities, making it a subject of research in pharmaceutical development. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C10H14N2O4
InChI:InChI=1/C10H14N2O4/c1-4-15-9(13)7-6-12(3)11-8(7)10(14)16-5-2/h6H,4-5H2,1-3H3
SMILES:CCOC(=O)c1cn(C)nc1C(=O)OCC
Synonyms:- Pyrazole-3,4-dicarboxylic acid, 1-methyl-, diethyl ester
- 1H-Pyrazole-3,4-dicarboxylic acid,1-methyl-,diethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.