CAS 105151-39-1
:5-EthylPyridine-2,3-Dicarboxylic Acid Diethyl Ester
Description:
5-Ethylpyridine-2,3-dicarboxylic acid diethyl ester is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features two carboxylic acid groups that are esterified with ethyl groups, enhancing its solubility in organic solvents. The presence of the ethyl substituent on the pyridine ring contributes to its hydrophobic characteristics, while the dicarboxylic acid moieties can participate in various chemical reactions, including esterification and amidation. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure allows for potential applications in synthesis and as an intermediate in the production of more complex molecules. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the nitrogen atom and the carboxylic acid groups. As with many organic compounds, safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.
Formula:C13H17NO4
InChI:InChI=1/C13H17NO4/c1-4-9-7-10(12(15)17-5-2)11(14-8-9)13(16)18-6-3/h7-8H,4-6H2,1-3H3
SMILES:CCc1cc(c(C(=O)OCC)nc1)C(=O)OCC
Synonyms:- 2,3-Pyridinedicarboxylic Acid, 5-Ethyl-, Diethyl Ester
- 5-Ethyl-2,3-pyridinedicarboxylic acid diethyl ester
- 5-Ethylquinolinic acid diethyl ester
- Diethyl 5-ethyl-2,3-pyridinedicarboxylate
- Diethyl 5-ethylpyridine-2,3-dicarboxylate
- Diethyl 5-ethylquinolinate
- T6Nj Bvo2 Cvo2 E2 [Wln]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,3-Pyridinedicarboxylic acid, 5-ethyl-, diethyl ester
CAS:Formula:C13H17NO4Purity:95%Color and Shape:SolidMolecular weight:251.2784Diethyl 5-ethylpyridine-2,3-dicarboxylate
CAS:Diethyl 5-ethylpyridine-2,3-dicarboxylatePurity:95%Molecular weight:251.28g/molImazethapyr Impurity (Diethyl 5-ethylpyridine-2,3-dicarboxylate)
CAS:Formula:C13H17NO4Color and Shape:Pale Yellow LiquidMolecular weight:251.28Diethyl 5-Ethylpyridine-2,3-dicarboxylate
CAS:Controlled ProductFormula:C13H17NO4Color and Shape:Light Yellow To YellowMolecular weight:251.28





