CymitQuimica logo

CAS 105161-33-9

:

3,3-Dimethoxy-2-(hydroxymethylene)-propionitrile sodium salt

Description:
3,3-Dimethoxy-2-(hydroxymethylene)-propionitrile sodium salt is a chemical compound characterized by its unique structure, which includes a propionitrile moiety and two methoxy groups. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the sodium salt form, which enhances its solubility compared to its neutral counterpart. The hydroxymethylene group contributes to its reactivity, making it a potential intermediate in organic synthesis. It may exhibit properties such as being a nucleophile or participating in condensation reactions. The presence of both methoxy and nitrile functional groups suggests potential applications in pharmaceuticals or agrochemicals, where such functionalities can influence biological activity. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken. Overall, this compound's characteristics make it of interest in various chemical research and industrial applications.
Formula:C6H9NNaO3
InChI:InChI=1/C6H9NO3.Na/c1-9-6(10-2)5(3-7)4-8;/h4,6,8H,1-2H3;/q;+1
SMILES:COC(C(=CO)C#N)OC.[Na]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.