CAS 10517-66-5
:4-(2-Hydroxy-2,2-diphenylethyl)benzonitrile
Description:
4-(2-Hydroxy-2,2-diphenylethyl)benzonitrile, with the CAS number 10517-66-5, is an organic compound characterized by its structural features, which include a benzonitrile moiety and a hydroxyl group attached to a diphenylethyl group. This compound typically exhibits a solid state at room temperature and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the hydroxyl group suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the diphenylethyl group contributes to its hydrophobic characteristics, which can affect its interaction with biological systems and solvents. The nitrile functional group (–C≡N) is known for its ability to participate in nucleophilic reactions, making this compound potentially useful in synthetic organic chemistry. Overall, the unique combination of functional groups in 4-(2-Hydroxy-2,2-diphenylethyl)benzonitrile provides a versatile platform for further chemical modifications and applications.
Formula:C21H17NO
InChI:InChI=1S/C21H17NO/c22-16-18-13-11-17(12-14-18)15-21(23,19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-14,23H,15H2
InChI key:InChIKey=XEERADXKZMFPDF-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(C#N)C=C1)(O)(C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- Benzonitrile, p-(2-hydroxy-2,2-diphenylethyl)-
- 4-(2-Hydroxy-2,2-diphenylethyl)benzonitrile
- Benzonitrile, 4-(2-hydroxy-2,2-diphenylethyl)-
- NSC 100703
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
