CAS 105172-79-0
:5-Bromo-2-chloro-3-(trifluoromethyl)benzenamine
Description:
5-Bromo-2-chloro-3-(trifluoromethyl)benzenamine, with the CAS number 105172-79-0, is an organic compound characterized by the presence of a bromine atom, a chlorine atom, and a trifluoromethyl group attached to a benzene ring that also contains an amino group. This compound is part of the aniline family, where the amino group (-NH2) is directly bonded to the aromatic ring, influencing its reactivity and solubility. The presence of halogen substituents (bromo and chloro) and the trifluoromethyl group (-CF3) contributes to its unique electronic properties, making it a potential candidate for various applications in pharmaceuticals and agrochemicals. The trifluoromethyl group, in particular, is known for enhancing lipophilicity and metabolic stability. Additionally, the compound may exhibit interesting biological activities due to its structural features, which can affect its interaction with biological targets. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.
Formula:C7H4BrClF3N
InChI:InChI=1S/C7H4BrClF3N/c8-3-1-4(7(10,11)12)6(9)5(13)2-3/h1-2H,13H2
InChI key:InChIKey=JJHIPAVNYPOJRL-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Cl)C(N)=CC(Br)=C1
Synonyms:- 5-Bromo-2-chloro-3-trifluoromethylaniline
- 5-Bromo-2-chloro-3-(trifluoromethyl)benzenamine
- Benzenamine, 5-bromo-2-chloro-3-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.