
CAS 105172-95-0
:D-myo-Inositol, 1-[(2R)-2,3-bis[(1-oxooctyl)oxy]propyl hydrogen phosphate]
Description:
D-myo-Inositol, 1-[(2R)-2,3-bis[(1-oxooctyl)oxy]propyl hydrogen phosphate], identified by its CAS number 105172-95-0, is a phospholipid derivative that plays a significant role in cellular signaling and membrane structure. This compound features a myo-inositol backbone, which is a cyclic sugar alcohol, and is modified with a phosphate group and long-chain alkoxy groups, contributing to its amphiphilic nature. The presence of the phosphate group allows for interactions with polar environments, while the hydrophobic alkyl chains enhance its ability to integrate into lipid bilayers. This structural configuration makes it relevant in various biological processes, including cell membrane dynamics and signal transduction pathways. Additionally, its unique properties may lend it potential applications in drug delivery systems and as a surfactant in various formulations. Overall, the compound exemplifies the intricate relationship between structure and function in biochemical systems.
Formula:C25H47O13P
InChI:InChI=1S/C25H47O13P/c1-3-5-7-9-11-13-18(26)35-15-17(37-19(27)14-12-10-8-6-4-2)16-36-39(33,34)38-25-23(31)21(29)20(28)22(30)24(25)32/h17,20-25,28-32H,3-16H2,1-2H3,(H,33,34)/t17-,20-,21-,22+,23-,24-,25-/m1/s1
InChI key:InChIKey=UPUKKDCTWWVPCJ-OZRWLNDDSA-N
SMILES:O(P(OC[C@@H](COC(CCCCCCC)=O)OC(CCCCCCC)=O)(=O)O)[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O
Synonyms:- D-myo-Inositol, 1-[(2R)-2,3-bis[(1-oxooctyl)oxy]propyl hydrogen phosphate]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Phosphatidylinositol dic8 (pi dic8)
CAS:Phosphatidylinositol dic8 (PI dic8) is a medicinal compound that has been shown to have potent anti-cancer properties. It is an inhibitor of the elastin cycle-associated protein kinase, which plays a critical role in tumor growth and proliferation. PI dic8 has been found to be effective against various types of cancer cells, including leukemia. In addition, it has been detected in human urine and Chinese medicinal herbs. PI dic8 induces apoptosis, or programmed cell death, in cancer cells, making it a promising candidate for the development of new cancer therapies. Its ability to inhibit protein synthesis and cell division also makes it a potential target for the development of new cancer drugs.Formula:C25H47O13PPurity:Min. 95%Molecular weight:586.6 g/mol
