CymitQuimica logo

CAS 105176-22-5

:

eto-et-me-benzothiazolylidbutenylid-et-et-di-ph-T

Description:
The chemical substance known as "eto-et-me-benzothiazolylidbutenylid-et-et-di-ph-T" with the CAS number 105176-22-5 is a complex organic compound that likely features a benzothiazole moiety, which is known for its applications in various fields such as pharmaceuticals and materials science. This compound may exhibit characteristics typical of benzothiazole derivatives, including potential biological activity, such as antimicrobial or antifungal properties. The presence of multiple functional groups suggests that it could participate in various chemical reactions, making it versatile in synthetic applications. Additionally, the compound's structure may influence its solubility, stability, and reactivity, which are crucial for its practical applications. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require empirical investigation or reference to specialized databases for precise characterization. Overall, this compound represents a class of substances that could be of interest in research and industrial applications, particularly in the development of new materials or therapeutic agents.
Formula:C39H40IN3O2S3
InChI:InChI=1/C39H40N3O2S3.HI/c1-6-40-31-24-27(5)20-22-32(31)45-34(40)25-30(44-9-4)21-23-33-39(43)42(8-3)36(46-33)26-35-41(7-2)37(28-16-12-10-13-17-28)38(47-35)29-18-14-11-15-19-29;/h10-26H,6-9H2,1-5H3;1H/q+1;/p-1/b30-21-,33-23+,34-25-;
Synonyms:
  • 5-[3-Ethoxy-4-(3-ethyl-5-methyl-2(3H)-benzothiazolylidene)-2-butenylidene]-3-ethyl-2-[(3-ethyl-4,5-diphenyl-2(3H)-thiazolylidene)methyl]-4,5-dihydro-4-oxothiazolium iodide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.