CAS 105184-37-0
:Splenopentin Acetate
Description:
Splenopentin Acetate, identified by the CAS number 105184-37-0, is a synthetic peptide that is derived from the splenic tissue. It is known for its immunomodulatory properties, which means it can influence the immune system's response. The substance is typically characterized by its ability to enhance lymphocyte proliferation and promote the production of various cytokines, thereby playing a role in immune regulation. Splenopentin Acetate is often studied for its potential therapeutic applications, particularly in conditions where immune modulation is beneficial, such as autoimmune diseases or in enhancing vaccine responses. In terms of physical properties, it is generally a white to off-white powder, soluble in water, and may require specific storage conditions to maintain its stability. As with many peptides, its activity can be influenced by factors such as concentration, formulation, and the presence of other compounds. Overall, Splenopentin Acetate represents a significant interest in both research and potential clinical applications related to immune health.
Formula:C35H59N9O13
InChI:InChI=1/C31H51N9O9.2C2H4O2/c1-17(2)25(29(47)39-23(30(48)49)16-18-8-10-19(41)11-9-18)40-28(46)22(12-13-24(42)43)38-27(45)21(7-3-4-14-32)37-26(44)20(33)6-5-15-36-31(34)35;2*1-2(3)4/h8-11,17,20-23,25,41H,3-7,12-16,32-33H2,1-2H3,(H,37,44)(H,38,45)(H,39,47)(H,40,46)(H,42,43)(H,48,49)(H4,34,35,36);2*1H3,(H,3,4)/t20-,21-,22-,23-,25-;;/m0../s1
SMILES:CC(C)[C@@H](C(=N[C@@H](Cc1ccc(cc1)O)C(=O)O)O)N=C([C@H](CCC(=O)O)N=C([C@H](CCCCN)N=C([C@H](CCCNC(=N)N)N)O)O)O.CC(=O)O.CC(=O)O
Synonyms:- Splenin Fragment 32-36 Acetate Salt
- Splenopentin Acetate Salt
- Sp-5 Acetate Salt
- Arg-Lys-Glu-Val-Tyr Acetate
- SP-5, Splenin Fragment 32-36, Splenopentin
- Arg-Lys-Glu-Val-Tyr Acetate Salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Splenopentin diacetate
CAS:Splenopentin diacetate (Splenin pentapeptide (32-36)) is a synthetic immunomodulating peptide and can reproduce the biological activities of splenin and thymicFormula:C33H55N9O11Purity:99.16%Color and Shape:SolidMolecular weight:753.84Splenopentin Acetate
CAS:Formula:C31H51N9O9·2(C2H4O2)Purity:95%~99%Color and Shape:White to Off-white PowderMolecular weight:813.9


