CAS 10519-73-0
:N-(2,4,5-trimethylbenzyl)acetamide
Description:
N-(2,4,5-trimethylbenzyl)acetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid and a substituted benzyl group. The presence of the 2,4,5-trimethylbenzyl moiety indicates that the compound has three methyl groups attached to the benzene ring, contributing to its hydrophobic characteristics and potentially influencing its solubility and reactivity. This compound typically appears as a solid or a viscous liquid, depending on the temperature and purity. Its molecular structure suggests that it may exhibit moderate polarity due to the amide group, which can engage in hydrogen bonding. N-(2,4,5-trimethylbenzyl)acetamide may be utilized in various chemical applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, its unique structure and functional groups make it a compound of interest in both industrial and research settings.
Formula:C12H17NO
InChI:InChI=1/C12H17NO/c1-8-5-10(3)12(6-9(8)2)7-13-11(4)14/h5-6H,7H2,1-4H3,(H,13,14)
SMILES:Cc1cc(C)c(cc1C)CN=C(C)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.