
CAS 105191-15-9
:2-(Hydroxymethyl)benzo[b]thiophene-5-carbonitrile
Description:
2-(Hydroxymethyl)benzo[b]thiophene-5-carbonitrile is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene core, a hydroxymethyl group, and a cyano group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and stability. The presence of the hydroxymethyl group suggests that it may participate in hydrogen bonding, influencing its solubility and interaction with other molecules. The cyano group, known for its electron-withdrawing properties, can enhance the compound's reactivity in nucleophilic substitution reactions. Additionally, the thiophene ring contributes to the compound's electronic properties, potentially allowing for applications in organic electronics or as a building block in the synthesis of more complex molecules. Overall, 2-(Hydroxymethyl)benzo[b]thiophene-5-carbonitrile is of interest in various fields, including medicinal chemistry and materials science, due to its structural features and potential biological activities.
Formula:C10H7NOS
InChI:InChI=1S/C10H7NOS/c11-5-7-1-2-10-8(3-7)4-9(6-12)13-10/h1-4,12H,6H2
InChI key:InChIKey=TUQCQABNZRVQEX-UHFFFAOYSA-N
SMILES:C(O)C1=CC=2C(S1)=CC=C(C#N)C2
Synonyms:- 2-(Hydroxymethyl)benzo[b]thiophene-5-carbonitrile
- 2-(Hydroxymethyl)-1-benzothiophene-5-carbonitrile
- Benzo[b]thiophene-5-carbonitrile, 2-(hydroxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.