CymitQuimica logo

CAS 105191-42-2

:

2-Formylbenzo[b]thiophene-5-carbonitrile

Description:
2-Formylbenzo[b]thiophene-5-carbonitrile is an organic compound characterized by its unique structure, which includes a thiophene ring fused to a benzene ring, along with a formyl group (-CHO) and a cyano group (-CN) attached to the aromatic system. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and reactivity due to the presence of electron-withdrawing groups. The formyl group can participate in various chemical reactions, including condensation and reduction, while the cyano group can serve as a versatile functional group for further synthetic transformations. The compound may also display interesting optical and electronic properties, making it of interest in materials science and organic electronics. Additionally, its potential applications could extend to pharmaceuticals and agrochemicals, given the importance of thiophene derivatives in medicinal chemistry. Overall, 2-Formylbenzo[b]thiophene-5-carbonitrile is a valuable compound for research and development in various chemical fields.
Formula:C10H5NOS
InChI:InChI=1S/C10H5NOS/c11-5-7-1-2-10-8(3-7)4-9(6-12)13-10/h1-4,6H
InChI key:InChIKey=WCTIDZVDTNFABJ-UHFFFAOYSA-N
SMILES:C(=O)C1=CC=2C(S1)=CC=C(C#N)C2
Synonyms:
  • 2-Formyl-1-benzothiophene-5-carbonitrile
  • Benzo[b]thiophene-5-carbonitrile, 2-formyl-
  • 5-Cyanobenzo[b]thiophene-2-carbaldehyde
  • 2-Formylbenzo[b]thiophene-5-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.