
CAS 1051919-32-4
:Cyclohexanamine, 3-methyl-N-propyl-, hydrochloride (1:1)
Description:
Cyclohexanamine, 3-methyl-N-propyl-, hydrochloride (1:1) is an organic compound characterized by its amine functional group, which is part of a cyclohexane ring. This substance features a propyl group and a methyl group attached to the nitrogen atom, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals and chemical synthesis. The presence of the hydrochloride indicates that it can exist as a stable crystalline solid, which is advantageous for storage and handling. Cyclohexanamine derivatives are often studied for their potential biological activities, including effects on the central nervous system. The compound's molecular structure suggests it may exhibit basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Safety data should be consulted for handling, as amines can be irritants and may pose health risks if not managed properly.
Formula:C10H21N·ClH
InChI:InChI=1S/C10H21N.ClH/c1-3-7-11-10-6-4-5-9(2)8-10;/h9-11H,3-8H2,1-2H3;1H
InChI key:InChIKey=FUPMTBJTGOQTGH-UHFFFAOYSA-N
SMILES:N(CCC)C1CC(C)CCC1.Cl
Synonyms:- Cyclohexanamine, 3-methyl-N-propyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.