
CAS 1051919-40-4
:Piperidine, 4-(propoxymethyl)-, hydrochloride (1:1)
Description:
Piperidine, 4-(propoxymethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a propoxymethyl group attached to the fourth position of the piperidine ring, enhancing its solubility and reactivity. As a hydrochloride salt, it is typically encountered in a crystalline form, which aids in its stability and handling. The presence of the hydrochloride indicates that it is a protonated form, making it more soluble in water compared to its free base form. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H19NO·ClH
InChI:InChI=1S/C9H19NO.ClH/c1-2-7-11-8-9-3-5-10-6-4-9;/h9-10H,2-8H2,1H3;1H
InChI key:InChIKey=MKKKPUOPQOHZND-UHFFFAOYSA-N
SMILES:C(OCCC)C1CCNCC1.Cl
Synonyms:- Piperidine, 4-(propoxymethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.