
CAS 1051919-42-6
:Piperidine, 4-[(2-cyclohexylethoxy)methyl]-, hydrochloride (1:1)
Description:
Piperidine, 4-[(2-cyclohexylethoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a substituent that includes a cyclohexyl group linked through an ethoxy chain, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the piperidine moiety often imparts basicity, allowing it to interact with biological systems effectively. Its structure suggests potential uses in medicinal chemistry, particularly in the development of compounds targeting neurological or psychiatric conditions. Additionally, the cyclohexyl group may influence the compound's lipophilicity and overall pharmacokinetic profile. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C14H27NO·ClH
InChI:InChI=1S/C14H27NO.ClH/c1-2-4-13(5-3-1)8-11-16-12-14-6-9-15-10-7-14;/h13-15H,1-12H2;1H
InChI key:InChIKey=KKFZNITZPBIPCG-UHFFFAOYSA-N
SMILES:C(COCC1CCNCC1)C2CCCCC2.Cl
Synonyms:- Piperidine, 4-[(2-cyclohexylethoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.