
CAS 1051941-67-3
:Acetamide, 2-chloro-N-[[1-(4-morpholinyl)cyclohexyl]methyl]-, hydrochloride (1:1)
Description:
Acetamide, 2-chloro-N-[[1-(4-morpholinyl)cyclohexyl]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential applications in medicinal chemistry. The presence of a chloro substituent suggests it may exhibit unique reactivity and biological activity. The morpholine ring contributes to its pharmacological properties, often enhancing solubility and bioavailability. As a hydrochloride salt, it is typically more stable and soluble in aqueous environments, making it suitable for various formulations. This compound may be of interest in research related to neuropharmacology or as a potential therapeutic agent, given the structural motifs that suggest interactions with biological targets. Its specific properties, such as melting point, solubility, and biological activity, would need to be evaluated through experimental studies to fully understand its behavior in different environments. Safety data and handling precautions should also be considered, as with any chemical substance, particularly those with potential biological activity.
Formula:C13H23ClN2O2·ClH
InChI:InChI=1S/C13H23ClN2O2.ClH/c14-10-12(17)15-11-13(4-2-1-3-5-13)16-6-8-18-9-7-16;/h1-11H2,(H,15,17);1H
InChI key:InChIKey=UAUOSYQSDMQSPV-UHFFFAOYSA-N
SMILES:C(NC(CCl)=O)C1(CCCCC1)N2CCOCC2.Cl
Synonyms:- Acetamide, 2-chloro-N-[[1-(4-morpholinyl)cyclohexyl]methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.