CAS 105202-02-6: 3-Amino-4-iodobenzotrifluoride

Description:3-Amino-4-iodobenzotrifluoride is an organic compound characterized by the presence of an amino group (-NH2), an iodine atom, and three fluorine atoms attached to a benzene ring. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased electronegativity and reactivity. The amino group contributes to its potential as a nucleophile in various chemical reactions, while the iodine atom can serve as a leaving group in substitution reactions. The presence of multiple electronegative fluorine atoms enhances the compound's polarity and can affect its solubility in different solvents. Additionally, the compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its molecular structure allows for various synthetic applications, particularly in the development of agrochemicals and fine chemicals. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Amino-4-iodobenzotrifluoride is a versatile compound with significant implications in both industrial and research settings.

Formula:C₉H₅FO₂

InChI:InChI=1/C9H5FO2/c10-6-1-2-9-7(5-6)8(11)3-4-12-9/h1-5H

Synonyms:
3-Amino-4-iodobenzotrifluoride
2-Iodo-5-(trifluoromethyl)aniline

Found 4 products.

Product data	Purity	Price range	Estimated delivery
3-Amino-4-iodobenzotrifluoride REF: IN-DA008R8RCAS: 105202-02-6	95%	34.00 €~484.00 €	Mon 03 Mar 25
3-Amino-4-iodobenzotrifluoride REF: 54-PC2015CAS: 105202-02-6	98%	54.00 €~541.00 €	Tue 04 Mar 25
3-Amino-4-iodobenzotrifluoride REF: 10-F233319CAS: 105202-02-6	95.0%	43.00 €~451.00 €	Thu 06 Mar 25
2-Iodo-5-(trifluoromethyl)aniline REF: 3D-FI64350CAS: 105202-02-6	Min. 95%	- - -	Discontinued product