
CAS 1052089-51-6
:Acetamide, 2-chloro-N-[4-(4-methyl-1-piperidinyl)phenyl]-, hydrochloride (1:1)
Description:
Acetamide, 2-chloro-N-[4-(4-methyl-1-piperidinyl)phenyl]-, hydrochloride (1:1), with CAS number 1052089-51-6, is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This substance features a chloro substituent and a piperidine ring, indicating potential biological activity, particularly in pharmacological contexts. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility in water and stability. Typically, compounds of this nature may exhibit properties such as moderate to high polarity due to the presence of both polar amide and piperidine groups. The molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as with any chemical, particularly those with potential biological activity. Further characterization would require specific analytical techniques such as NMR, IR spectroscopy, or mass spectrometry to elucidate its structure and confirm purity.
Formula:C14H19ClN2O·ClH
InChI:InChI=1S/C14H19ClN2O.ClH/c1-11-6-8-17(9-7-11)13-4-2-12(3-5-13)16-14(18)10-15;/h2-5,11H,6-10H2,1H3,(H,16,18);1H
InChI key:InChIKey=NARMLNBPVVRIIN-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C1=CC=C(C=C1)N2CCC(C)CC2.Cl
Synonyms:- Acetamide, 2-chloro-N-[4-(4-methyl-1-piperidinyl)phenyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.