
CAS 1052089-53-8
:1-Piperazinecarboximidamide, sulfate (1:1)
Description:
1-Piperazinecarboximidamide, sulfate (1:1) is a chemical compound characterized by its piperazine ring structure, which is a six-membered cyclic amine featuring two nitrogen atoms. This compound contains a carboximidamide functional group, contributing to its potential biological activity. The sulfate component indicates that the compound is present as a salt, which can influence its solubility and stability in various solvents. Typically, compounds like this may exhibit properties such as being hygroscopic and having moderate to high solubility in water due to the presence of polar functional groups. The presence of the piperazine moiety often suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting the central nervous system or other therapeutic areas. Additionally, the compound may exhibit basic properties due to the nitrogen atoms in the piperazine ring, which can participate in hydrogen bonding and interactions with biological targets. Overall, 1-Piperazinecarboximidamide, sulfate (1:1) is of interest in medicinal chemistry and may warrant further investigation for its pharmacological properties.
Formula:C5H12N4·H2O4S
InChI:InChI=1S/C5H12N4.H2O4S/c6-5(7)9-3-1-8-2-4-9;1-5(2,3)4/h8H,1-4H2,(H3,6,7);(H2,1,2,3,4)
InChI key:InChIKey=GMPKWLTVZFDPEM-UHFFFAOYSA-N
SMILES:C(=N)(N)N1CCNCC1.S(=O)(=O)(O)O
Synonyms:- 1-Piperazinecarboximidamide, sulfate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.