CAS 105211-79-8
:3-Ethyl-4-hydroxybenzaldehyde
Description:
3-Ethyl-4-hydroxybenzaldehyde, with the CAS number 105211-79-8, is an organic compound characterized by its aromatic structure, featuring a hydroxyl group (-OH) and an aldehyde group (-CHO) attached to a benzene ring. The presence of the ethyl group at the 3-position and the hydroxyl group at the 4-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in organic solvents and exhibits moderate solubility in water due to the polar hydroxyl group. The compound is known for its potential applications in organic synthesis, particularly in the production of various pharmaceuticals and agrochemicals. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. As with many aromatic aldehydes, it may undergo typical reactions such as oxidation, reduction, and electrophilic substitution, which are fundamental to its reactivity and utility in chemical synthesis.
Formula:C9H10O2
InChI:InChI=1S/C9H10O2/c1-2-8-5-7(6-10)3-4-9(8)11/h3-6,11H,2H2,1H3
InChI key:InChIKey=GANMHEZDTJWGJW-UHFFFAOYSA-N
SMILES:C(C)C1=CC(C=O)=CC=C1O
Synonyms:- 3-Ethyl-4-Hydroxybenzaldehyde
- 4-Hydroxy-3-ethylbenzaldehyde
- Benzaldehyde, 3-ethyl-4-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.