
CAS 105211-80-1
:1-(5-Bromo-2-hydroxyphenyl)-1-butanone
Description:
1-(5-Bromo-2-hydroxyphenyl)-1-butanone, with the CAS number 105211-80-1, is an organic compound characterized by its structure, which includes a butanone moiety attached to a phenolic ring that is substituted with a bromine atom and a hydroxyl group. This compound typically exhibits properties associated with both ketones and phenolic compounds, such as moderate polarity and potential for hydrogen bonding due to the hydroxyl group. The presence of the bromine atom can influence its reactivity, making it a candidate for various chemical reactions, including electrophilic substitutions. Additionally, the compound may display biological activity, which could be of interest in pharmaceutical research. Its solubility in organic solvents and limited solubility in water is typical for such compounds, and it may be sensitive to light and heat, necessitating careful handling and storage. Overall, 1-(5-Bromo-2-hydroxyphenyl)-1-butanone is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C10H11BrO2
InChI:InChI=1S/C10H11BrO2/c1-2-3-9(12)8-6-7(11)4-5-10(8)13/h4-6,13H,2-3H2,1H3
InChI key:InChIKey=NIWDQGAGNUZPSG-UHFFFAOYSA-N
SMILES:C(CCC)(=O)C1=C(O)C=CC(Br)=C1
Synonyms:- 1-(5-Bromo-2-hydroxyphenyl)-1-butanone
- 1-Butanone, 1-(5-bromo-2-hydroxyphenyl)-
- 4-Bromo-2-(butanoyl)phenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.