CAS 105212-09-7

7-HYDROXY-4-OXO-8-PROPYL-4H-CHROMENE-2-CARBOXYLIC ACID

Description:

7-Hydroxy-4-oxo-8-propyl-4H-chromene-2-carboxylic acid, with the CAS number 105212-09-7, is a chemical compound belonging to the class of chromenes, which are characterized by a fused benzene and pyran ring structure. This compound features a hydroxyl group (-OH) and a carboxylic acid group (-COOH), contributing to its potential as a bioactive molecule. The presence of the propyl group enhances its lipophilicity, which may influence its solubility and biological activity. The keto group (C=O) at the 4-position and the hydroxyl group at the 7-position can participate in various chemical reactions, making it a versatile compound in synthetic organic chemistry. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of anti-inflammatory or antioxidant agents. Additionally, the chromene framework is known for its presence in natural products and may exhibit interesting photophysical properties. Further studies would be necessary to fully elucidate its biological activities and potential therapeutic applications.

Formula: C₁₃H₁₂O₅

InChI: InChI=1/C13H12O5/c1-2-3-7-9(14)5-4-8-10(15)6-11(13(16)17)18-12(7)8/h4-6,14H,2-3H2,1H3,(H,16,17)

SMILES: CCCc1c(ccc2c(=O)cc(C(=O)O)oc12)O

Synonyms:

• 4H-1-benzopyran-2-carboxylic acid, 7-hydroxy-4-oxo-8-propyl-
• 7-HYDROXY-4-OXO-8-PROPYL-4H-CHROMENE-2-CARBOXYLIC ACID

7-Hydroxy-4-oxo-8-propyl-4H-chromene-2-carboxylic acid

CAS: 105212-09-7

7-Hydroxy-4-oxo-8-propyl-4H-chromene-2-carboxylic acid

Purity: ≥95%

Molecular weight: 248.23g/mol

Ref: 54-OR97992