CAS 105212-28-0

6-cyano-1-benzothiophene-2-carboxylic acid

Description:

6-Cyano-1-benzothiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzothiophene ring fused with a carboxylic acid and a cyano group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in polar solvents due to the presence of the carboxylic acid functional group. The cyano group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cycloadditions. The presence of the thiophene ring imparts aromatic stability and can influence the electronic properties of the molecule, potentially making it useful in organic electronics or as a building block in the synthesis of more complex molecules. Additionally, compounds like this may exhibit biological activity, which could be explored in pharmaceutical applications. Overall, 6-cyano-1-benzothiophene-2-carboxylic acid is a versatile compound with potential applications in materials science and medicinal chemistry.

Formula: C₁₀H₅NO₂S

InChI: InChI=1/C10H5NO2S/c11-5-6-1-2-7-4-9(10(12)13)14-8(7)3-6/h1-4H,(H,12,13)

SMILES: c1cc2cc(C(=O)O)sc2cc1C#N

6-Cyano-benzo[b]thiophene-2-carboxylic acid

CAS: 105212-28-0

Formula: C₁₀H₅NO₂S

Purity: 95.0%

Molecular weight: 203.22

Ref: 10-F545653