CymitQuimica logo

CAS 1052137-51-5

:

2,2′-Dicyano[1,1′-biphenyl]-4,4′-dicarboxylic acid

Description:
2,2′-Dicyano[1,1′-biphenyl]-4,4′-dicarboxylic acid, identified by its CAS number 1052137-51-5, is an organic compound characterized by its biphenyl structure with two cyano groups and two carboxylic acid groups attached to the aromatic rings. This compound typically exhibits high thermal stability and is soluble in polar solvents due to the presence of carboxylic acid functional groups. The cyano groups contribute to its electron-withdrawing properties, enhancing its reactivity and potential applications in organic synthesis and materials science. It may also display interesting optical properties, making it a candidate for use in organic electronics or as a dye. The presence of multiple functional groups allows for various chemical modifications, which can be exploited in the development of advanced materials. Overall, 2,2′-Dicyano[1,1′-biphenyl]-4,4′-dicarboxylic acid is a versatile compound with potential applications in fields such as organic chemistry, materials science, and nanotechnology.
Formula:C16H8N2O4
InChI:InChI=1S/C16H8N2O4/c17-7-11-5-9(15(19)20)1-3-13(11)14-4-2-10(16(21)22)6-12(14)8-18/h1-6H,(H,19,20)(H,21,22)
InChI key:InChIKey=LYTLEAAZOOAVMH-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=CC(C(O)=O)=C1)C2=C(C#N)C=C(C(O)=O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-4,4′-dicarboxylic acid, 2,2′-dicyano-
  • 2,2′-Dicyano[1,1′-biphenyl]-4,4′-dicarboxylic acid
  • 2,2′-Dicyano-4,4′-biphenyldicarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.