CAS 1052147-86-0

4-[1,1′-Biphenyl]-2-yl-N-[(4-cyanophenyl)methyl]-1-piperazinehexanamide

Description:

4-[1,1′-Biphenyl]-2-yl-N-[(4-cyanophenyl)methyl]-1-piperazinehexanamide is a synthetic organic compound characterized by its complex structure, which includes a biphenyl moiety, a piperazine ring, and a hexanamide chain. This compound features multiple functional groups, including an amide and a cyanophenyl group, which contribute to its potential biological activity and solubility properties. The presence of the piperazine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit lipophilic characteristics due to the biphenyl and cyanophenyl groups, which could influence its pharmacokinetics and bioavailability. Additionally, the compound's specific stereochemistry and substituent positions can significantly affect its reactivity and interaction with other molecules. Overall, this compound may be explored for its potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting various biological pathways.

Formula: C₃₀H₃₄N₄O

InChI: InChI=1S/C30H34N4O/c31-23-25-14-16-26(17-15-25)24-32-30(35)13-5-2-8-18-33-19-21-34(22-20-33)29-12-7-6-11-28(29)27-9-3-1-4-10-27/h1,3-4,6-7,9-12,14-17H,2,5,8,13,18-22,24H2,(H,32,35)

InChI key: InChIKey=BQEDZLDNNBDKDS-UHFFFAOYSA-N

SMILES: C(CCCCC(NCC1=CC=C(C#N)C=C1)=O)N2CCN(C3=C(C=CC=C3)C4=CC=CC=C4)CC2

Synonyms:

• 1-Piperazinehexanamide, 4-[1,1′-biphenyl]-2-yl-N-[(4-cyanophenyl)methyl]-
• 4-[1,1′-Biphenyl]-2-yl-N-[(4-cyanophenyl)methyl]-1-piperazinehexanamide

LP-211

CAS: 1052147-86-0

LP-211

Purity: ≥98%

Molecular weight: 466.62g/mol

Ref: 54-BUP09923

LP-211

CAS: 1052147-86-0

LP-211 is a brain penetrant selective agonist for a 5-HT7 receptor (Ki: 0.58 nM), and >300-fold selectivity over the 5-HT1A receptor.

Formula: C₃₀H₃₄N₄O

Purity: 98.65%

Color and Shape: Solid

Molecular weight: 466.62

Ref: TM-T5387

LP-211

Controlled Product

CAS: 1052147-86-0

Formula: C₃₀H₃₄N₄O

Color and Shape: Neat

Molecular weight: 466.617

Ref: TR-L473405

LP-211

CAS: 1052147-86-0

LP-211 is a drug that binds to the 5-hydroxytryptamine 7 receptor (5-HT7) with high affinity and specificity. It is a potent and selective antagonist of the 5-HT7 receptor, which has been shown to be involved in the regulation of brain functions, neurodevelopmental processes and locomotor activity. LP-211 also inhibits the binding of serotonin to its receptors, suggesting that it may have therapeutic potential for treating neuropsychiatric disorders such as depression or anxiety. LP-211 is an irreversible inhibitor of the 5-HT7 receptor, which blocks the activation of this receptor by serotonin. This drug also has pharmacokinetic properties that are suitable for oral administration.

Formula: C₃₀H₃₄N₄O

Purity: Min. 95%

Molecular weight: 466.62 g/mol

Ref: 3D-CSB14786