CAS 10522-18-6
:Methyl 2-undecynoate
Description:
Methyl 2-undecynoate is an organic compound classified as an alkyne and an ester. It features a long carbon chain, consisting of eleven carbon atoms, with a triple bond between the second and third carbon atoms from the methyl ester functional group. This compound is typically a colorless to pale yellow liquid with a characteristic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. Methyl 2-undecynoate is known for its applications in organic synthesis, particularly in the production of various pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the triple bond, making it a useful intermediate in various chemical reactions, including addition reactions and polymerization processes. Safety data indicates that it should be handled with care, as it may cause irritation to the skin and eyes, and appropriate safety measures should be taken during its use and storage.
Formula:C12H20O2
InChI:InChI=1S/C12H20O2/c1-3-4-5-6-7-8-9-10-11-12(13)14-2/h3-9H2,1-2H3
InChI key:InChIKey=YPUZOJRRZPRXNV-UHFFFAOYSA-N
SMILES:C(C#CC(OC)=O)CCCCCCC
Synonyms:- Methyl 2-undecynoate
- 2-Undecynoic acid, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
