CAS 10522-26-6

2-Methyl-1-undecanol

Description:

2-Methyl-1-undecanol is a long-chain alcohol characterized by its molecular structure, which includes a hydroxyl (-OH) group attached to a carbon chain of eleven carbon atoms, with a methyl group at the second position. This compound is classified as a primary alcohol due to the presence of the hydroxyl group on the terminal carbon. It is typically a colorless liquid with a waxy texture and exhibits hydrophobic properties, making it insoluble in water but soluble in organic solvents. The presence of the long hydrocarbon chain contributes to its relatively high boiling point and low volatility compared to shorter-chain alcohols. 2-Methyl-1-undecanol is often used in the production of surfactants, lubricants, and as a potential intermediate in organic synthesis. Additionally, it may exhibit antimicrobial properties and can be utilized in various industrial applications. Its physical and chemical properties, such as viscosity and surface tension, are influenced by its molecular structure, making it relevant in both chemical research and practical applications.

Formula: C₁₂H₂₆O

InChI: InChI=1S/C12H26O/c1-3-4-5-6-7-8-9-10-12(2)11-13/h12-13H,3-11H2,1-2H3

InChI key: InChIKey=FGZXHVORLPLICA-UHFFFAOYSA-N

SMILES: C(CCCCCCCC)C(CO)C

Synonyms:

• 1-Undecanol, 2-methyl-
• 2-Methyl-1-undecanol