CAS 1052209-51-4

α-Amino-1H-pyrrolo[2,3-b]pyridine-3-acetic acid

Description:

α-Amino-1H-pyrrolo[2,3-b]pyridine-3-acetic acid is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyridine ring. This compound features an amino group and an acetic acid moiety, contributing to its potential as a bioactive molecule. It is typically classified as an amino acid derivative, which may exhibit various biological activities, making it of interest in pharmaceutical research. The presence of the pyrrolo and pyridine rings can influence its solubility, stability, and reactivity, as well as its interaction with biological targets. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Additionally, its specific stereochemistry and functional groups may play a crucial role in determining its pharmacokinetic properties and biological efficacy. As with many compounds in this class, further studies are necessary to fully elucidate its properties and potential applications in drug development.

Formula: C₉H₉N₃O₂

InChI: InChI=1S/C9H9N3O2/c10-7(9(13)14)6-4-12-8-5(6)2-1-3-11-8/h1-4,7H,10H2,(H,11,12)(H,13,14)

InChI key: InChIKey=JAOJSANZQPPJLZ-UHFFFAOYSA-N

SMILES: C(C(O)=O)(N)C=1C=2C(NC1)=NC=CC2

Synonyms:

• α-Amino-1H-pyrrolo[2,3-b]pyridine-3-acetic acid
• 1H-Pyrrolo[2,3-b]pyridine-3-acetic acid, α-amino-
• 2-Amino-2-[1H-pyrrolo[2,3-b]pyridin-3-yl]acetic acid

D,L-7-Aza-3-indolylglycine

CAS: 1052209-51-4

Molecular weight: 191.19

Ref: 7W-GM0440