
CAS 1052241-71-0
:2,3′-Difluoro-4-methoxy-1,1′-biphenyl
Description:
2,3′-Difluoro-4-methoxy-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2 and 3 positions on one of the phenyl rings, along with a methoxy group (-OCH3) at the 4 position, contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative fluorine atoms and the methoxy group, which can influence its solubility in various solvents. Additionally, the fluorine substituents may enhance its stability and reactivity in certain chemical reactions, making it of interest in fields such as materials science and medicinal chemistry. The compound's molecular structure suggests potential applications in organic electronics or as a precursor in the synthesis of more complex molecules. Its specific interactions and behavior in chemical reactions would depend on the surrounding conditions, such as temperature and solvent choice.
Formula:C13H10F2O
InChI:InChI=1S/C13H10F2O/c1-16-11-5-6-12(13(15)8-11)9-3-2-4-10(14)7-9/h2-8H,1H3
InChI key:InChIKey=JUQFKGANZUOEPU-UHFFFAOYSA-N
SMILES:FC1=C(C2=CC(F)=CC=C2)C=CC(OC)=C1
Synonyms:- 2,3′-Difluoro-4-methoxy-1,1′-biphenyl
- 2,3′-Difluoro-4-methoxybiphenyl
- 2-Fluoro-1-(3-fluorophenyl)-4-methoxybenzene
- 1,1′-Biphenyl, 2,3′-difluoro-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.