
CAS 10523-35-0
:2-Nonylpyridine
Description:
2-Nonylpyridine is an organic compound characterized by a pyridine ring substituted with a nonyl group at the second position. It is a colorless to pale yellow liquid with a distinctive odor, often described as fishy or amine-like. This compound is known for its hydrophobic properties due to the long nonyl alkyl chain, which influences its solubility in organic solvents while rendering it less soluble in water. 2-Nonylpyridine exhibits basicity, typical of pyridine derivatives, and can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. It is utilized in various applications, including as a ligand in coordination chemistry and as an intermediate in the synthesis of other organic compounds. Additionally, it has been studied for its potential biological activities, including antimicrobial properties. Safety data indicates that it should be handled with care, as it may cause irritation to the skin and eyes, and proper safety measures should be observed during its use and handling.
Formula:C14H23N
InChI:InChI=1S/C14H23N/c1-2-3-4-5-6-7-8-11-14-12-9-10-13-15-14/h9-10,12-13H,2-8,11H2,1H3
InChI key:InChIKey=OXXAGZCRGWURQM-UHFFFAOYSA-N
SMILES:C(CCCCCCCC)C1=CC=CC=N1
Synonyms:- Pyridine, 2-nonyl-
- 2-Nonylpyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
