CymitQuimica logo

CAS 10523-47-4

:

2-HYDROXYBENZOYLACETONITRILE

Description:
2-Hydroxybenzoylacetonitrile, with the CAS number 10523-47-4, is an organic compound characterized by its functional groups, which include a hydroxyl group (-OH), a carbonyl group (C=O), and a nitrile group (-C≡N). This compound typically appears as a crystalline solid and is soluble in polar organic solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. Its structure features a benzene ring substituted with a hydroxyl group and an acetonitrile moiety, contributing to its reactivity and potential applications in organic synthesis. The compound may exhibit various chemical properties, such as acidity due to the hydroxyl group and nucleophilicity from the nitrile group, making it useful in various chemical reactions, including condensation and substitution reactions. Additionally, it may have applications in pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H7NO2
InChI:InChI=1S/C9H7NO2/c10-6-5-9(12)7-3-1-2-4-8(7)11/h1-4,11H,5H2
InChI key:DOBMOJUDUIGABG-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)C(=O)CC#N)O
Synonyms:
  • 3-(2-Hydroxy-Phenyl)-3-Oxo-Propionitrile
Found 4 products.