CAS 105234-34-2
:Ethyl 4-oxo-1(4H)-quinazolineacetate
Description:
Ethyl 4-oxo-1(4H)-quinazolineacetate, with the CAS number 105234-34-2, is a chemical compound that belongs to the class of quinazoline derivatives. It typically features a quinazoline ring system, which is a bicyclic structure composed of a benzene and a pyrimidine ring. This compound is characterized by the presence of an ethyl ester functional group and a keto group at the 4-position of the quinazoline ring. Ethyl 4-oxo-1(4H)-quinazolineacetate may exhibit biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its properties include potential solubility in organic solvents and moderate stability under standard laboratory conditions. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or cyclizations, due to the presence of reactive functional groups. As with many quinazoline derivatives, it may possess pharmacological properties, including antimicrobial or anticancer activities, although specific biological data would need to be referenced for detailed insights.
Formula:C12H12N2O3
InChI:InChI=1S/C12H12N2O3/c1-2-17-11(15)7-14-8-13-12(16)9-5-3-4-6-10(9)14/h3-6,8H,2,7H2,1H3
InChI key:InChIKey=XYTQXPSDLZLZBD-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)N1C=2C(C(=O)N=C1)=CC=CC2
Synonyms:- Ethyl 4-oxo-1(4H)-quinazolineacetate
- 1(4H)-Quinazolineacetic acid, 4-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
