CymitQuimica logo

CAS 10524-09-1

:

1,1,1,6,6,6-hexafluorohexa-2,4-diyne

Description:
1,1,1,6,6,6-Hexafluorohexa-2,4-diyne is a fluorinated organic compound characterized by its unique structure, which includes a hexa-2,4-diyne backbone with six fluorine atoms attached to specific carbon atoms. This compound is notable for its high degree of fluorination, which imparts significant chemical stability and alters its physical properties, such as low surface tension and high hydrophobicity. The presence of multiple triple bonds in the hexa-2,4-diyne structure contributes to its reactivity, making it a potential candidate for various chemical reactions, including polymerization and cross-coupling reactions. Additionally, the fluorine atoms enhance its thermal and chemical resistance, making it suitable for applications in specialized fields such as materials science and fluorinated polymer synthesis. However, due to the presence of multiple fluorine atoms, it may also exhibit environmental persistence and bioaccumulation potential, necessitating careful handling and consideration of its environmental impact. Overall, 1,1,1,6,6,6-hexafluorohexa-2,4-diyne is a compound of interest in both research and industrial applications.
Formula:C6F6
InChI:InChI=1/C6F6/c7-5(8,9)3-1-2-4-6(10,11)12
SMILES:C(#CC(F)(F)F)C#CC(F)(F)F
Synonyms:
  • 2,4-Hexadiyne, 1,1,1,6,6,6-hexafluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.