
CAS 1052415-02-7
:Benzenemethanamine, 3,5-dichloro-4-(1-methylethoxy)-, hydrochloride (1:1)
Description:
Benzenemethanamine, 3,5-dichloro-4-(1-methylethoxy)-, hydrochloride (1:1), identified by its CAS number 1052415-02-7, is a chemical compound characterized by its amine functional group and aromatic structure. This substance features a benzene ring substituted with dichloro and methoxy groups, which influence its reactivity and solubility. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its stability and solubility in polar solvents, particularly water. The dichloro substituents suggest potential applications in pharmaceuticals or agrochemicals, as halogenated compounds often exhibit unique biological activities. Additionally, the methoxy group can affect the compound's electronic properties and steric hindrance, which may play a role in its interaction with biological targets. Overall, this compound's specific characteristics, including its molecular structure and functional groups, contribute to its potential utility in various chemical and industrial applications.
Formula:C10H13Cl2NO·ClH
InChI:InChI=1S/C10H13Cl2NO.ClH/c1-6(2)14-10-8(11)3-7(5-13)4-9(10)12;/h3-4,6H,5,13H2,1-2H3;1H
InChI key:InChIKey=DRIQEAGXQYKZOM-UHFFFAOYSA-N
SMILES:O(C(C)C)C1=C(Cl)C=C(CN)C=C1Cl.Cl
Synonyms:- Benzenemethanamine, 3,5-dichloro-4-(1-methylethoxy)-, hydrochloride (1:1)
- (3,5-Dichloro-4-isopropoxybenzyl)amine hydrochloride
- (3,5-Dichloro-4-isopropoxyphenyl)methanamine hydrochloride
- 3,5-Dichloro-4-isopropoxybenzylamine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.