CAS 105250-17-7
:2-Aminopyridine-4-methanol
Description:
2-Aminopyridine-4-methanol, with the CAS number 105250-17-7, is an organic compound characterized by the presence of both an amino group and a hydroxymethyl group attached to a pyridine ring. This compound typically exhibits properties associated with both amines and alcohols, such as being polar and capable of forming hydrogen bonds, which can influence its solubility in various solvents. The amino group can participate in nucleophilic reactions, while the hydroxymethyl group may engage in hydrogen bonding and contribute to the compound's reactivity. 2-Aminopyridine-4-methanol is often studied for its potential applications in pharmaceuticals and organic synthesis, as derivatives of aminopyridines are known for their biological activity. Its structural features may also allow it to act as a ligand in coordination chemistry. Overall, the compound's unique functional groups and aromatic nature make it a subject of interest in various chemical research fields.
Formula:C6H8N2O
InChI:InChI=1/C6H8N2O/c7-6-3-5(4-9)1-2-8-6/h1-3,9H,4H2,(H2,7,8)/p+1
Synonyms:- (2-Amino-pyridin-4-yl)-methanol
- 2-Amino-4-(Hydroxymethyl)Pyridinium
- 2-Amino-4-pyridinemethanol
- 2-Amino-4-hydroxymethylpyridine
- 4-Pyridinemethanol,2-amino-(9CI)
- 2-AMINOPYRIDINE-4-METHANOL
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-4-pyridinylmethanol
CAS:Formula:C6H8N2OPurity:>98.0%(GC)(T)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:124.142-Aminopyridine-4-methanol, 97%
CAS:2-Aminopyridine-4-methanol is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU refereFormula:C6H8N2OPurity:97%Color and Shape:powder, Pale cream to yellow or brownMolecular weight:124.14(2-AMINOPYRIDIN-4-YL)METHANOL
CAS:Formula:C6H8N2OPurity:98%Color and Shape:SolidMolecular weight:124.14052-Amino-4-(hydroxymethyl)pyridine
CAS:2-Amino-4-(hydroxymethyl)pyridineFormula:C6H8N2OPurity:98%Color and Shape: off-white solidMolecular weight:124.14g/mol2-Aminopyridine-4-methanol
CAS:Formula:C6H8N2OPurity:98%Color and Shape:Yellow powderMolecular weight:124.143




