CAS 105252-98-0

4-Amino-5-fluoro-2(1H)-pyridinone

Description:

4-Amino-5-fluoro-2(1H)-pyridinone, with the CAS number 105252-98-0, is a heterocyclic organic compound characterized by its pyridinone structure, which includes a pyridine ring with an amino group and a fluorine atom. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the amino group. The fluorine atom can influence its reactivity and biological activity, making it of interest in medicinal chemistry and drug development. The compound may participate in hydrogen bonding due to the amino group, affecting its interactions with biological targets. Additionally, its structural features suggest potential applications in the synthesis of pharmaceuticals or agrochemicals, particularly in the development of compounds with antimicrobial or antiviral properties. As with many nitrogen-containing heterocycles, it may also exhibit unique electronic properties, making it a subject of study in materials science and organic electronics.

Formula: C₅H₅FN₂O

InChI: InChI=1S/C5H5FN2O/c6-3-2-8-5(9)1-4(3)7/h1-2H,(H3,7,8,9)

InChI key: InChIKey=OXWQVERSCXJERS-UHFFFAOYSA-N

SMILES: NC=1C(F)=CNC(=O)C1

Synonyms:

• 2(1H)-Pyridinone, 4-amino-5-fluoro-
• 4-Amino-5-fluoro-2(1H)-pyridinone
• 4-Amino-5-fluoropyrid-2-one