CAS 1052530-79-6

1,4-Benzenediamine, N1-[4-(4-pyridinyl)-2-thiazolyl]-, hydrobromide (1:1)

Description:

1,4-Benzenediamine, N1-[4-(4-pyridinyl)-2-thiazolyl]-, hydrobromide (1:1) is a chemical compound characterized by its complex structure, which includes a benzene ring with two amine groups and a thiazole-pyridine moiety. This compound typically appears as a crystalline solid and is soluble in polar solvents, reflecting its ionic hydrobromide form. The presence of both amine and heterocyclic groups suggests potential applications in pharmaceuticals, particularly in the development of biologically active molecules. The thiazole and pyridine components may contribute to its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the hydrobromide salt form enhances its stability and solubility, which is advantageous for formulation in various applications. Safety data should be consulted, as compounds with amine functionalities can exhibit toxicity and require appropriate handling precautions. Overall, this compound represents a unique intersection of organic chemistry and potential therapeutic utility.

Formula: C₁₄H₁₂N₄S·BrH

InChI: InChI=1S/C14H12N4S.BrH/c15-11-1-3-12(4-2-11)17-14-18-13(9-19-14)10-5-7-16-8-6-10;/h1-9H,15H2,(H,17,18);1H

InChI key: InChIKey=VMAYVHOFWBMQQR-UHFFFAOYSA-N

SMILES: N(C1=NC(=CS1)C=2C=CN=CC2)C3=CC=C(N)C=C3.Br

Synonyms:

• 1,4-Benzenediamine, N1-[4-(4-pyridinyl)-2-thiazolyl]-, hydrobromide (1:1)