CAS 1052530-87-6

Phenol, 2-amino-4-chloro-3,5-dimethyl-, hydrochloride (1:1)

Description:

Phenol, 2-amino-4-chloro-3,5-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its phenolic structure, which includes an amino group and multiple methyl substituents on the aromatic ring. The presence of a chlorine atom at the para position relative to the amino group contributes to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. This compound may exhibit properties such as antimicrobial activity, and its derivatives are often studied for their potential therapeutic effects. The molecular interactions of this compound can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry. Safety data should be consulted, as compounds with amino and halogen substituents can pose health risks, including toxicity or irritant effects. Proper handling and storage conditions are essential to ensure safety in laboratory settings.

Formula: C₈H₁₀ClNO·ClH

InChI: InChI=1S/C8H10ClNO.ClH/c1-4-3-6(11)8(10)5(2)7(4)9;/h3,11H,10H2,1-2H3;1H

InChI key: InChIKey=FQXYFSATLRRGRO-UHFFFAOYSA-N

SMILES: ClC1=C(C)C(N)=C(O)C=C1C.Cl

Synonyms:

• Phenol, 2-amino-4-chloro-3,5-dimethyl-, hydrochloride (1:1)