CAS 105254-01-1
:2-METHYL-4-OXO-4-(2'-METHOXYPHENYL)BUTYRIC ACID
Description:
2-Methyl-4-oxo-4-(2'-methoxyphenyl)butyric acid, identified by its CAS number 105254-01-1, is a chemical compound that belongs to the class of substituted aromatic acids. This substance features a butyric acid backbone with a ketone functional group and a methoxy-substituted phenyl group, contributing to its unique chemical properties. It is characterized by its potential applications in pharmaceuticals and organic synthesis, often serving as an intermediate in the production of various bioactive compounds. The presence of the methoxy group enhances its lipophilicity, which may influence its biological activity and solubility in organic solvents. Additionally, the compound may exhibit specific reactivity patterns typical of carboxylic acids and ketones, such as esterification and acylation. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, 2-methyl-4-oxo-4-(2'-methoxyphenyl)butyric acid is a noteworthy compound in the realm of organic chemistry with implications for further research and development.
Formula:C12H14O4
InChI:InChI=1/C12H14O4/c1-8(12(14)15)7-10(13)9-5-3-4-6-11(9)16-2/h3-6,8H,7H2,1-2H3,(H,14,15)
SMILES:CC(CC(=O)c1ccccc1OC)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
