CAS 105254-11-3

α,α,2,5-Tetramethylbenzeneethanamine

Description:

α,α,2,5-Tetramethylbenzeneethanamine, also known by its CAS number 105254-11-3, is an organic compound characterized by its amine functional group and a complex hydrocarbon structure. This compound features a benzene ring substituted with four methyl groups and an ethylamine side chain, contributing to its unique properties. The presence of multiple methyl groups enhances its hydrophobic character, making it less soluble in water but more soluble in organic solvents. Its structure suggests potential applications in organic synthesis and as a building block in the development of pharmaceuticals or agrochemicals. Additionally, the steric hindrance introduced by the bulky methyl groups may influence its reactivity and interactions with biological systems. Safety data indicates that, like many amines, it may pose risks such as skin and respiratory irritation, necessitating appropriate handling precautions. Overall, α,α,2,5-Tetramethylbenzeneethanamine is a compound of interest in both industrial and research contexts due to its distinctive structural features and potential applications.

Formula: C₁₂H₁₉N

InChI: InChI=1S/C12H19N/c1-9-5-6-10(2)11(7-9)8-12(3,4)13/h5-7H,8,13H2,1-4H3

InChI key: InChIKey=HTIRJSKBFZZFBI-UHFFFAOYSA-N

SMILES: C(C(C)(C)N)C1=C(C)C=CC(C)=C1

Synonyms:

• Benzeneethanamine, α,α,2,5-tetramethyl-
• Phenethylamine, α,α,2,5-tetramethyl-
• α,α,2,5-Tetramethylbenzeneethanamine